| Identification |
|---|
| Common Name | (2-trans-6-trans)-farnesoate |
|---|
| Class | Small Molecule |
|---|
| Description | A polyunsaturated fatty acid anion obtained by deprotonation of the carboxy group of (2E,6E)-farnesoic acid; major species at pH 7.3. |
|---|
| Contaminant Sources | |
|---|
| Contaminant Type | Not Available |
|---|
| Chemical Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (2E,6E)-Farnesoic acid | Generator | | (2-trans-6-trans)-Farnesoate | MetaCyc | | (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienoic acid | MetaCyc | | (2E,6E)-Farnesenic acid | MetaCyc | | (2E,6E)-Farnesic acid | MetaCyc | | (2E,6E)-Farnesylic acid | MetaCyc | | (2E,6E)-3,7,11-Trimethyl-dodeca-2,6,10-trienoic acid | MetaCyc | | trans,trans-Farnesoic acid | MetaCyc | | (e,e)-Farnesoic acid | MetaCyc | | all-trans-Farnesoic acid | MetaCyc | | (2-trans-6-trans) Farnesoic acid | MetaCyc | | (2-trans-6-trans)-Farnesoic acid | Generator | | (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrienoate | Generator | | (2E,6E)-Farnesenate | Generator | | (2E,6E)-Farnesate | Generator | | (2E,6E)-Farnesylate | Generator | | (2E,6E)-3,7,11-Trimethyl-dodeca-2,6,10-trienoate | Generator | | trans,trans-Farnesoate | Generator | | (e,e)-Farnesoate | Generator | | all-trans-Farnesoate | Generator | | (2-trans-6-trans) Farnesoate | Generator |
|
|---|
| Chemical Formula | C15H23O2 |
|---|
| Average Molecular Mass | 235.348 g/mol |
|---|
| Monoisotopic Mass | 235.170 g/mol |
|---|
| CAS Registry Number | Not Available |
|---|
| IUPAC Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|
| Traditional Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoate |
|---|
| SMILES | [H]\C(CC\C(C)=C(/[H])C([O-])=O)=C(\C)CCC=C(C)C |
|---|
| InChI Identifier | InChI=1S/C15H24O2/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15(16)17/h7,9,11H,5-6,8,10H2,1-4H3,(H,16,17)/p-1/b13-9+,14-11+ |
|---|
| InChI Key | WJHFZYAELPOJIV-IJFRVEDASA-M |
|---|